C15H14ClF3N3O+ — CID 135847612
2-[2-[[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]amino]ethyliminomethyl]phenol (PubChem CID 135847612) has the molecular formula C15H14ClF3N3O+ and a molecular weight of 344.74 g/mol. Its IUPAC name is 2-[2-[[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]amino]ethyliminomethyl]phenol.
| Compound Name | 2-[2-[[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]amino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 135847612 |
| Molecular Formula | C15H14ClF3N3O+ |
| Molecular Weight | 344.74 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[2-[[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]amino]ethyliminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/CCNc1[nH+]cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H13ClF3N3O/c16-12-7-11(15(17,18)19)9-22-14(12)21-6-5-20-8-10-3-1-2-4-13(10)23/h1-4,7-9,23H,5-6H2,(H,21,22)/p+1/b20-8+ |
| InChIKey | YVIRIHHGTNJKLT-DNTJNYDQSA-O |
| XLogP | 3.41 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|