C18H10Cl2F3N3O3 — CID 126113442
N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126113442) has the molecular formula C18H10Cl2F3N3O3 and a molecular weight of 444.20 g/mol. Its IUPAC name is N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126113442 |
| Molecular Formula | C18H10Cl2F3N3O3 |
| Molecular Weight | 444.20 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N/N=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C18H10Cl2F3N3O3/c19-13-4-1-10(7-14(13)20)17-6-3-12(29-17)9-24-25-15-5-2-11(18(21,22)23)8-16(15)26(27)28/h1-9,25H/b24-9+ |
| InChIKey | UZFWYVBZGNEYCS-PGGKNCGUSA-N |
| XLogP | 6.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.20 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|