C19H11F3N4O3 — CID 126101540
4-[5-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 126101540) has the molecular formula C19H11F3N4O3 and a molecular weight of 400.32 g/mol. Its IUPAC name is 4-[5-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126101540 |
| Molecular Formula | C19H11F3N4O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-[5-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=N\Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C19H11F3N4O3/c20-19(21,22)14-5-7-16(17(9-14)26(27)28)25-24-11-15-6-8-18(29-15)13-3-1-12(10-23)2-4-13/h1-9,11,25H/b24-11- |
| InChIKey | HMMBSYLVZCSHDF-MYKKPKGFSA-N |
| XLogP | 5.19 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|