C13H9F3N4O3S — CID 2804039
[[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thiourea (PubChem CID 2804039) has the molecular formula C13H9F3N4O3S and a molecular weight of 358.30 g/mol. Its IUPAC name is [[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thiourea.
| Compound Name | [[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 2804039 |
| Molecular Formula | C13H9F3N4O3S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(-c2ccc(C(F)(F)F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H9F3N4O3S/c14-13(15,16)7-1-3-9(10(5-7)20(21)22)11-4-2-8(23-11)6-18-19-12(17)24/h1-6H,(H3,17,19,24) |
| InChIKey | QEQCKQAZPYBERI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|