C19H14Cl3N3O3 — CID 50885633
2,4,6-trichloro-N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]aniline (PubChem CID 50885633) has the molecular formula C19H14Cl3N3O3 and a molecular weight of 438.70 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 50885633 |
| Molecular Formula | C19H14Cl3N3O3 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 2,4,6-trichloro-N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]aniline |
| SMILES | Cc1cc(-c2ccc(C=NNc3c(Cl)cc(Cl)cc3Cl)o2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H14Cl3N3O3/c1-10-5-14(17(25(26)27)6-11(10)2)18-4-3-13(28-18)9-23-24-19-15(21)7-12(20)8-16(19)22/h3-9,24H,1-2H3 |
| InChIKey | DTCMAIKSRRWABR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|