C26H19Cl3N2O3 — CID 50885617
2-phenylethyl 4-[5-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 50885617) has the molecular formula C26H19Cl3N2O3 and a molecular weight of 513.81 g/mol. Its IUPAC name is 2-phenylethyl 4-[5-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 2-phenylethyl 4-[5-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50885617 |
| Molecular Formula | C26H19Cl3N2O3 |
| Molecular Weight | 513.81 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 2-phenylethyl 4-[5-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | O=C(OCCc1ccccc1)c1ccc(-c2ccc(C=NNc3c(Cl)cc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C26H19Cl3N2O3/c27-20-14-22(28)25(23(29)15-20)31-30-16-21-10-11-24(34-21)18-6-8-19(9-7-18)26(32)33-13-12-17-4-2-1-3-5-17/h1-11,14-16,31H,12-13H2 |
| InChIKey | OIXCDTSRPQRYNJ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.81 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|