C19H13Cl2N3O — CID 19060025
2-[5-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 19060025) has the molecular formula C19H13Cl2N3O and a molecular weight of 370.24 g/mol. Its IUPAC name is 2-[5-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 2-[5-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 19060025 |
| Molecular Formula | C19H13Cl2N3O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-[5-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(/C=N/NCc2c(Cl)cccc2Cl)o1 |
| InChI | InChI=1S/C19H13Cl2N3O/c20-17-6-3-7-18(21)16(17)12-24-23-11-14-8-9-19(25-14)15-5-2-1-4-13(15)10-22/h1-9,11,24H,12H2/b23-11+ |
| InChIKey | BWEQAUAXQLZDAL-FOKLQQMPSA-N |
| XLogP | 5.25 |
| TPSA | 61.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|