C22H19N3O2 — CID 92657677
N-[(Z)-[5-(2-cyanophenyl)furan-2-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 92657677) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(Z)-[5-(2-cyanophenyl)furan-2-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(Z)-[5-(2-cyanophenyl)furan-2-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 92657677 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(Z)-[5-(2-cyanophenyl)furan-2-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C\c2ccc(-c3ccccc3C#N)o2)c(C)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-15-7-8-17(16(2)11-15)12-22(26)25-24-14-19-9-10-21(27-19)20-6-4-3-5-18(20)13-23/h3-11,14H,12H2,1-2H3,(H,25,26)/b24-14- |
| InChIKey | QZWFEXVYNQRWHC-OYKKKHCWSA-N |
| XLogP | 4.13 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|