C17H11Cl3N2O — CID 50886197
4-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline (PubChem CID 50886197) has the molecular formula C17H11Cl3N2O and a molecular weight of 365.65 g/mol. Its IUPAC name is 4-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline.
| Compound Name | 4-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 50886197 |
| Molecular Formula | C17H11Cl3N2O |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 4-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline |
| SMILES | Clc1ccc(NN=Cc2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C17H11Cl3N2O/c18-11-4-6-12(7-5-11)22-21-10-13-8-9-16(23-13)14-2-1-3-15(19)17(14)20/h1-10,22H |
| InChIKey | YOYVOPPUUUMBMP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|