C18H13Cl3N2O — CID 50886039
3-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylaniline (PubChem CID 50886039) has the molecular formula C18H13Cl3N2O and a molecular weight of 379.67 g/mol. Its IUPAC name is 3-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylaniline.
| Compound Name | 3-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 50886039 |
| Molecular Formula | C18H13Cl3N2O |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 3-chloro-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylaniline |
| SMILES | Cc1ccc(NN=Cc2ccc(-c3cccc(Cl)c3Cl)o2)cc1Cl |
| InChI | InChI=1S/C18H13Cl3N2O/c1-11-5-6-12(9-16(11)20)23-22-10-13-7-8-17(24-13)14-3-2-4-15(19)18(14)21/h2-10,23H,1H3 |
| InChIKey | AXDMZGBFXNUVHN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|