C19H13ClN2O5 — CID 126223635
5-[(2E)-2-[[5-(2-carboxyphenyl)furan-2-yl]methylidene]hydrazinyl]-2-chlorobenzoic acid (PubChem CID 126223635) has the molecular formula C19H13ClN2O5 and a molecular weight of 384.78 g/mol. Its IUPAC name is 5-[(2E)-2-[[5-(2-carboxyphenyl)furan-2-yl]methylidene]hydrazinyl]-2-chlorobenzoic acid.
| Compound Name | 5-[(2E)-2-[[5-(2-carboxyphenyl)furan-2-yl]methylidene]hydrazinyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 126223635 |
| Molecular Formula | C19H13ClN2O5 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 5-[(2E)-2-[[5-(2-carboxyphenyl)furan-2-yl]methylidene]hydrazinyl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(N/N=C/c2ccc(-c3ccccc3C(=O)O)o2)ccc1Cl |
| InChI | InChI=1S/C19H13ClN2O5/c20-16-7-5-11(9-15(16)19(25)26)22-21-10-12-6-8-17(27-12)13-3-1-2-4-14(13)18(23)24/h1-10,22H,(H,23,24)(H,25,26)/b21-10+ |
| InChIKey | UUXRSJOBBZQOII-UFFVCSGVSA-N |
| XLogP | 4.44 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|