C13H12F2O2 — CID 62633834
1-[5-(2,5-difluorophenyl)furan-2-yl]propan-1-ol (PubChem CID 62633834) has the molecular formula C13H12F2O2 and a molecular weight of 238.23 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)furan-2-yl]propan-1-ol.
| Compound Name | 1-[5-(2,5-difluorophenyl)furan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 62633834 |
| Molecular Formula | C13H12F2O2 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)furan-2-yl]propan-1-ol |
| SMILES | CCC(O)c1ccc(-c2cc(F)ccc2F)o1 |
| InChI | InChI=1S/C13H12F2O2/c1-2-11(16)13-6-5-12(17-13)9-7-8(14)3-4-10(9)15/h3-7,11,16H,2H2,1H3 |
| InChIKey | AQIWXBFORRICNX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |