C14H12BrF3O2 — CID 62633836
1-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol (PubChem CID 62633836) has the molecular formula C14H12BrF3O2 and a molecular weight of 349.15 g/mol. Its IUPAC name is 1-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol.
| Compound Name | 1-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 62633836 |
| Molecular Formula | C14H12BrF3O2 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol |
| SMILES | CCC(O)c1ccc(-c2ccc(Br)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C14H12BrF3O2/c1-2-11(19)13-6-5-12(20-13)9-4-3-8(15)7-10(9)14(16,17)18/h3-7,11,19H,2H2,1H3 |
| InChIKey | HYDQOIHWQYSMPP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |