C15H18O2 — CID 62633649
1-[5-(2,4-dimethylphenyl)furan-2-yl]propan-1-ol (PubChem CID 62633649) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[5-(2,4-dimethylphenyl)furan-2-yl]propan-1-ol.
| Compound Name | 1-[5-(2,4-dimethylphenyl)furan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 62633649 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[5-(2,4-dimethylphenyl)furan-2-yl]propan-1-ol |
| SMILES | CCC(O)c1ccc(-c2ccc(C)cc2C)o1 |
| InChI | InChI=1S/C15H18O2/c1-4-13(16)15-8-7-14(17-15)12-6-5-10(2)9-11(12)3/h5-9,13,16H,4H2,1-3H3 |
| InChIKey | ZPHFVAGGFGGPCO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |