C14H11BrF3NO3 — CID 170872796
3-amino-3-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid (PubChem CID 170872796) has the molecular formula C14H11BrF3NO3 and a molecular weight of 378.14 g/mol. Its IUPAC name is 3-amino-3-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid.
| Compound Name | 3-amino-3-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 170872796 |
| Molecular Formula | C14H11BrF3NO3 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 3-amino-3-[5-[4-bromo-2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid |
| SMILES | NC(CC(=O)O)c1ccc(-c2ccc(Br)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C14H11BrF3NO3/c15-7-1-2-8(9(5-7)14(16,17)18)11-3-4-12(22-11)10(19)6-13(20)21/h1-5,10H,6,19H2,(H,20,21) |
| InChIKey | UFDIJDVQJMQXDP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |