About ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate
ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate (PubChem CID 113377396) has the molecular formula C12H9F2NO3S
and a molecular weight of 285.27 g/mol. Its IUPAC name is ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate.
Analyze ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate (CID 113377396) is ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate is CCOC(=O)c1coc(Sc2cc(F)ccc2F)n1.
What is the InChIKey of ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate?
The InChIKey is ZINUPPJXEAFWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO3S/c1-2-17-11(16)9-6-18-12(15-9)19-10-5-7(13)3-4-8(10)14/h3-6H,2H2,1H3.
What are the key properties of ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate?
ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate has a molecular weight of 285.27 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,5-difluorophenyl)sulfanyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 113377396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).