About ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate
ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 51205234) has the molecular formula C14H12F2N2O3S2
and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate |
| PubChem CID | 51205234 |
| Molecular Formula | C14H12F2N2O3S2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)CSc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C14H12F2N2O3S2/c1-2-21-13(20)10-6-23-14(17-10)18-12(19)7-22-11-4-3-8(15)5-9(11)16/h3-6H,2,7H2,1H3,(H,17,18,19) |
| InChIKey | RCXTXIKTEAHEHN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate (CID 51205234) is ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(NC(=O)CSc2ccc(F)cc2F)n1.
What is the InChIKey of ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate?
The InChIKey is RCXTXIKTEAHEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O3S2/c1-2-21-13(20)10-6-23-14(17-10)18-12(19)7-22-11-4-3-8(15)5-9(11)16/h3-6H,2,7H2,1H3,(H,17,18,19).
What are the key properties of ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate?
ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate has a molecular weight of 358.39 g/mol, XLogP of 3.33, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[2-(2,4-difluorophenyl)sulfanylacetyl]amino]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 51205234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).