C13H13N3O3S — CID 169358237
ethyl 2-[2-(carbamothioylamino)phenyl]-1,3-oxazole-4-carboxylate (PubChem CID 169358237) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is ethyl 2-[2-(carbamothioylamino)phenyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[2-(carbamothioylamino)phenyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 169358237 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | ethyl 2-[2-(carbamothioylamino)phenyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccccc2NC(N)=S)n1 |
| InChI | InChI=1S/C13H13N3O3S/c1-2-18-12(17)10-7-19-11(15-10)8-5-3-4-6-9(8)16-13(14)20/h3-7H,2H2,1H3,(H3,14,16,20) |
| InChIKey | VAUMKAAZHABOER-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|