C11H11N3S2 — CID 169357373
[2-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea (PubChem CID 169357373) has the molecular formula C11H11N3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169357373 |
| Molecular Formula | C11H11N3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)phenyl]thiourea |
| SMILES | Cc1nc(-c2ccccc2NC(N)=S)cs1 |
| InChI | InChI=1S/C11H11N3S2/c1-7-13-10(6-16-7)8-4-2-3-5-9(8)14-11(12)15/h2-6H,1H3,(H3,12,14,15) |
| InChIKey | ODSJIAGXRKLTOE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|