C17H20N2OS — CID 90626222
N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]cyclohexanecarboxamide (PubChem CID 90626222) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 90626222 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[2-(2-methyl-1,3-thiazol-4-yl)phenyl]cyclohexanecarboxamide |
| SMILES | Cc1nc(-c2ccccc2NC(=O)C2CCCCC2)cs1 |
| InChI | InChI=1S/C17H20N2OS/c1-12-18-16(11-21-12)14-9-5-6-10-15(14)19-17(20)13-7-3-2-4-8-13/h5-6,9-11,13H,2-4,7-8H2,1H3,(H,19,20) |
| InChIKey | YPPHTJJBHWKMOA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |