C16H16N2O4S — CID 168569919
dimethyl (E)-2-[2-(2-methyl-1,3-thiazol-4-yl)anilino]but-2-enedioate (PubChem CID 168569919) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(2-methyl-1,3-thiazol-4-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(2-methyl-1,3-thiazol-4-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569919 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | dimethyl (E)-2-[2-(2-methyl-1,3-thiazol-4-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1-c1csc(C)n1)C(=O)OC |
| InChI | InChI=1S/C16H16N2O4S/c1-10-17-14(9-23-10)11-6-4-5-7-12(11)18-13(16(20)22-3)8-15(19)21-2/h4-9,18H,1-3H3/b13-8+ |
| InChIKey | VBHUBAIYPJJOGE-MDWZMJQESA-N |
| XLogP | 2.76 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|