C20H21N7O4 — CID 168568391
dimethyl (E)-2-[2-[3-[(4,6-dimethylpyrimidin-2-yl)amino]-1H-1,2,4-triazol-5-yl]anilino]but-2-enedioate (PubChem CID 168568391) has the molecular formula C20H21N7O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[3-[(4,6-dimethylpyrimidin-2-yl)amino]-1H-1,2,4-triazol-5-yl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[3-[(4,6-dimethylpyrimidin-2-yl)amino]-1H-1,2,4-triazol-5-yl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568391 |
| Molecular Formula | C20H21N7O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | dimethyl (E)-2-[2-[3-[(4,6-dimethylpyrimidin-2-yl)amino]-1H-1,2,4-triazol-5-yl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1-c1nc(Nc2nc(C)cc(C)n2)n[nH]1)C(=O)OC |
| InChI | InChI=1S/C20H21N7O4/c1-11-9-12(2)22-19(21-11)25-20-24-17(26-27-20)13-7-5-6-8-14(13)23-15(18(29)31-4)10-16(28)30-3/h5-10,23H,1-4H3,(H2,21,22,24,25,26,27)/b15-10+ |
| InChIKey | TZMHRDARACJSBM-XNTDXEJSSA-N |
| XLogP | 2.26 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|