C18H11ClF10N2O2 — CID 23631003
ethyl 6-chloro-4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]pyridine-3-carboxylate (PubChem CID 23631003) has the molecular formula C18H11ClF10N2O2 and a molecular weight of 512.73 g/mol. Its IUPAC name is ethyl 6-chloro-4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 23631003 |
| Molecular Formula | C18H11ClF10N2O2 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | ethyl 6-chloro-4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1Nc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C18H11ClF10N2O2/c1-2-33-14(32)9-7-30-13(19)6-12(9)31-11-4-3-8(5-10(11)20)15(21,22)16(23,24)17(25,26)18(27,28)29/h3-7H,2H2,1H3,(H,30,31) |
| InChIKey | KJRWQMYQQFBJMR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|