C17H14Cl2N2O3 — CID 165134483
methyl 6-chloro-4-[[(1S,2S)-2-(3-chlorophenyl)cyclopropanecarbonyl]amino]pyridine-3-carboxylate (PubChem CID 165134483) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is methyl 6-chloro-4-[[(1S,2S)-2-(3-chlorophenyl)cyclopropanecarbonyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-4-[[(1S,2S)-2-(3-chlorophenyl)cyclopropanecarbonyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 165134483 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | methyl 6-chloro-4-[[(1S,2S)-2-(3-chlorophenyl)cyclopropanecarbonyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Cl)cc1NC(=O)[C@H]1C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-24-17(23)13-8-20-15(19)7-14(13)21-16(22)12-6-11(12)9-3-2-4-10(18)5-9/h2-5,7-8,11-12H,6H2,1H3,(H,20,21,22)/t11-,12+/m1/s1 |
| InChIKey | IMXXQAQOOQTSSN-NEPJUHHUSA-N |
| XLogP | 3.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|