C11H13ClN3O3Si — CID 174042248
CID 174042248 (PubChem CID 174042248) has the molecular formula C11H13ClN3O3Si and a molecular weight of 298.78 g/mol.
| Compound Name | CID 174042248 |
|---|---|
| PubChem CID | 174042248 |
| Molecular Formula | C11H13ClN3O3Si |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cnc(Cl)nc1N[C@@]1([Si])CCOC1 |
| InChI | InChI=1S/C11H13ClN3O3Si/c1-2-18-9(16)7-5-13-10(12)14-8(7)15-11(19)3-4-17-6-11/h5H,2-4,6H2,1H3,(H,13,14,15)/t11-/m1/s1 |
| InChIKey | IIWXIXXVLKMZDH-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|