C22H37N3O2 — CID 118685052
ethyl 2-methyl-4-[(1,2,2,3,3,4,4,5,5-nonamethylcyclopentyl)amino]pyrimidine-5-carboxylate (PubChem CID 118685052) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is ethyl 2-methyl-4-[(1,2,2,3,3,4,4,5,5-nonamethylcyclopentyl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methyl-4-[(1,2,2,3,3,4,4,5,5-nonamethylcyclopentyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 118685052 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | ethyl 2-methyl-4-[(1,2,2,3,3,4,4,5,5-nonamethylcyclopentyl)amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C)nc1NC1(C)C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C22H37N3O2/c1-12-27-17(26)15-13-23-14(2)24-16(15)25-22(11)20(7,8)18(3,4)19(5,6)21(22,9)10/h13H,12H2,1-11H3,(H,23,24,25) |
| InChIKey | HRLPQVNBZPQEBS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |