C15H19N5O4 — CID 108775876
ethyl 4-[(4-ethoxycarbonyl-1-methylpyrazol-5-yl)amino]-2-methylpyrimidine-5-carboxylate (PubChem CID 108775876) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is ethyl 4-[(4-ethoxycarbonyl-1-methylpyrazol-5-yl)amino]-2-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[(4-ethoxycarbonyl-1-methylpyrazol-5-yl)amino]-2-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108775876 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | ethyl 4-[(4-ethoxycarbonyl-1-methylpyrazol-5-yl)amino]-2-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C)nc1Nc1c(C(=O)OCC)cnn1C |
| InChI | InChI=1S/C15H19N5O4/c1-5-23-14(21)10-7-16-9(3)18-12(10)19-13-11(8-17-20(13)4)15(22)24-6-2/h7-8H,5-6H2,1-4H3,(H,16,18,19) |
| InChIKey | PUFQPAXKXJWPFU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |