C12H14ClN5O2 — CID 108775899
ethyl 5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108775899) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is ethyl 5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108775899 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | ethyl 5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1Nc1cc(Cl)nc(C)n1 |
| InChI | InChI=1S/C12H14ClN5O2/c1-4-20-12(19)8-6-14-18(3)11(8)17-10-5-9(13)15-7(2)16-10/h5-6H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | FAEXPIVLFPCDKQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |