C12H14N6O3 — CID 110492422
ethyl 1-methyl-5-(pyrazin-2-ylcarbamoylamino)pyrazole-4-carboxylate (PubChem CID 110492422) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is ethyl 1-methyl-5-(pyrazin-2-ylcarbamoylamino)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-(pyrazin-2-ylcarbamoylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 110492422 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 1-methyl-5-(pyrazin-2-ylcarbamoylamino)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)Nc1cnccn1 |
| InChI | InChI=1S/C12H14N6O3/c1-3-21-11(19)8-6-15-18(2)10(8)17-12(20)16-9-7-13-4-5-14-9/h4-7H,3H2,1-2H3,(H2,14,16,17,20) |
| InChIKey | JWFOSYZQBGGAFL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |