C15H22ClN3O3 — CID 167516579
ethyl 2-chloro-4-[[(1S)-1-cyclohexyl-2-hydroxyethyl]amino]pyrimidine-5-carboxylate (PubChem CID 167516579) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(1S)-1-cyclohexyl-2-hydroxyethyl]amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-[[(1S)-1-cyclohexyl-2-hydroxyethyl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 167516579 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 2-chloro-4-[[(1S)-1-cyclohexyl-2-hydroxyethyl]amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)nc1N[C@H](CO)C1CCCCC1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-2-22-14(21)11-8-17-15(16)19-13(11)18-12(9-20)10-6-4-3-5-7-10/h8,10,12,20H,2-7,9H2,1H3,(H,17,18,19)/t12-/m1/s1 |
| InChIKey | DPAJYBITVQJAHP-GFCCVEGCSA-N |
| XLogP | 2.66 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |