C20H17ClN2O4 — CID 67358158
2-[(1-carboxy-2-phenylethyl)amino]-6-chloro-8-methylquinoline-3-carboxylic acid (PubChem CID 67358158) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 2-[(1-carboxy-2-phenylethyl)amino]-6-chloro-8-methylquinoline-3-carboxylic acid.
| Compound Name | 2-[(1-carboxy-2-phenylethyl)amino]-6-chloro-8-methylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67358158 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[(1-carboxy-2-phenylethyl)amino]-6-chloro-8-methylquinoline-3-carboxylic acid |
| SMILES | Cc1cc(Cl)cc2cc(C(=O)O)c(NC(Cc3ccccc3)C(=O)O)nc12 |
| InChI | InChI=1S/C20H17ClN2O4/c1-11-7-14(21)9-13-10-15(19(24)25)18(23-17(11)13)22-16(20(26)27)8-12-5-3-2-4-6-12/h2-7,9-10,16H,8H2,1H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | FONDLRQIVRSOGG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |