C14H13ClFN3O3 — CID 87138080
methyl (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 87138080) has the molecular formula C14H13ClFN3O3 and a molecular weight of 325.73 g/mol. Its IUPAC name is methyl (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 87138080 |
| Molecular Formula | C14H13ClFN3O3 |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | methyl (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C14H13ClFN3O3/c1-22-13(21)11(6-8-2-4-9(20)5-3-8)18-12-10(16)7-17-14(15)19-12/h2-5,7,11,20H,6H2,1H3,(H,17,18,19)/t11-/m0/s1 |
| InChIKey | XOCVJXDNMHXVRB-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |