C18H19NO4 — CID 20689587
methyl 2-(2-acetylanilino)-3-(4-hydroxyphenyl)propanoate (PubChem CID 20689587) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl 2-(2-acetylanilino)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-(2-acetylanilino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 20689587 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 2-(2-acetylanilino)-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)Nc1ccccc1C(C)=O |
| InChI | InChI=1S/C18H19NO4/c1-12(20)15-5-3-4-6-16(15)19-17(18(22)23-2)11-13-7-9-14(21)10-8-13/h3-10,17,19,21H,11H2,1-2H3 |
| InChIKey | NFFHMKCLDCWATJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |