C24H21NO4 — CID 21034963
ethenyl (2S)-2-(2-benzoylanilino)-3-(4-hydroxyphenyl)propanoate (PubChem CID 21034963) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is ethenyl (2S)-2-(2-benzoylanilino)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | ethenyl (2S)-2-(2-benzoylanilino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 21034963 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | ethenyl (2S)-2-(2-benzoylanilino)-3-(4-hydroxyphenyl)propanoate |
| SMILES | C=COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21NO4/c1-2-29-24(28)22(16-17-12-14-19(26)15-13-17)25-21-11-7-6-10-20(21)23(27)18-8-4-3-5-9-18/h2-15,22,25-26H,1,16H2/t22-/m0/s1 |
| InChIKey | WAEFWQDQXMUFSA-QFIPXVFZSA-N |
| XLogP | 4.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|