C20H17FN6O3 — CID 67413877
methyl 2-[3-[[5-fluoro-2-(3-hydroxyanilino)pyrimidin-4-yl]amino]indazol-1-yl]acetate (PubChem CID 67413877) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is methyl 2-[3-[[5-fluoro-2-(3-hydroxyanilino)pyrimidin-4-yl]amino]indazol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[5-fluoro-2-(3-hydroxyanilino)pyrimidin-4-yl]amino]indazol-1-yl]acetate |
|---|---|
| PubChem CID | 67413877 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | methyl 2-[3-[[5-fluoro-2-(3-hydroxyanilino)pyrimidin-4-yl]amino]indazol-1-yl]acetate |
| SMILES | COC(=O)Cn1nc(Nc2nc(Nc3cccc(O)c3)ncc2F)c2ccccc21 |
| InChI | InChI=1S/C20H17FN6O3/c1-30-17(29)11-27-16-8-3-2-7-14(16)18(26-27)24-19-15(21)10-22-20(25-19)23-12-5-4-6-13(28)9-12/h2-10,28H,11H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | DZPPZIYHEGINSC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |