C15H17F3N6O — CID 21081128
4-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide (PubChem CID 21081128) has the molecular formula C15H17F3N6O and a molecular weight of 354.34 g/mol. Its IUPAC name is 4-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 21081128 |
| Molecular Formula | C15H17F3N6O |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
| SMILES | NCCCNc1nc(Nc2ccc(C(N)=O)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N6O/c16-15(17,18)11-8-22-14(24-13(11)21-7-1-6-19)23-10-4-2-9(3-5-10)12(20)25/h2-5,8H,1,6-7,19H2,(H2,20,25)(H2,21,22,23,24) |
| InChIKey | DLUQWVUMENMVGD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|