C16H27N3O3 — CID 107243446
tert-butyl N-[3-[2-(3-aminopropylamino)ethoxy]phenyl]carbamate (PubChem CID 107243446) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(3-aminopropylamino)ethoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(3-aminopropylamino)ethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 107243446 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | tert-butyl N-[3-[2-(3-aminopropylamino)ethoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(OCCNCCCN)c1 |
| InChI | InChI=1S/C16H27N3O3/c1-16(2,3)22-15(20)19-13-6-4-7-14(12-13)21-11-10-18-9-5-8-17/h4,6-7,12,18H,5,8-11,17H2,1-3H3,(H,19,20) |
| InChIKey | HJEPBEQTWHIARD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|