C24H23ClF2N6O2 — CID 175492703
N-[3-[[5-chloro-2-[4-fluoro-3-(2-methylprop-2-enoylamino)anilino]pyrimidin-4-yl]amino]propyl]-4-fluorobenzamide (PubChem CID 175492703) has the molecular formula C24H23ClF2N6O2 and a molecular weight of 500.94 g/mol. Its IUPAC name is N-[3-[[5-chloro-2-[4-fluoro-3-(2-methylprop-2-enoylamino)anilino]pyrimidin-4-yl]amino]propyl]-4-fluorobenzamide.
| Compound Name | N-[3-[[5-chloro-2-[4-fluoro-3-(2-methylprop-2-enoylamino)anilino]pyrimidin-4-yl]amino]propyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 175492703 |
| Molecular Formula | C24H23ClF2N6O2 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[3-[[5-chloro-2-[4-fluoro-3-(2-methylprop-2-enoylamino)anilino]pyrimidin-4-yl]amino]propyl]-4-fluorobenzamide |
| SMILES | C=C(C)C(=O)Nc1cc(Nc2ncc(Cl)c(NCCCNC(=O)c3ccc(F)cc3)n2)ccc1F |
| InChI | InChI=1S/C24H23ClF2N6O2/c1-14(2)22(34)32-20-12-17(8-9-19(20)27)31-24-30-13-18(25)21(33-24)28-10-3-11-29-23(35)15-4-6-16(26)7-5-15/h4-9,12-13H,1,3,10-11H2,2H3,(H,29,35)(H,32,34)(H2,28,30,31,33) |
| InChIKey | JHCJLXSWTFGEKO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|