C24H21ClF4N6O2 — CID 118973555
N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-2,4,6-trifluorobenzamide (PubChem CID 118973555) has the molecular formula C24H21ClF4N6O2 and a molecular weight of 536.92 g/mol. Its IUPAC name is N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-2,4,6-trifluorobenzamide.
| Compound Name | N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 118973555 |
| Molecular Formula | C24H21ClF4N6O2 |
| Molecular Weight | 536.92 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-2,4,6-trifluorobenzamide |
| SMILES | C=CC(=O)N(C)c1cc(Nc2ncc(Cl)c(NCCCNC(=O)c3c(F)cc(F)cc3F)n2)ccc1F |
| InChI | InChI=1S/C24H21ClF4N6O2/c1-3-20(36)35(2)19-11-14(5-6-16(19)27)33-24-32-12-15(25)22(34-24)30-7-4-8-31-23(37)21-17(28)9-13(26)10-18(21)29/h3,5-6,9-12H,1,4,7-8H2,2H3,(H,31,37)(H2,30,32,33,34) |
| InChIKey | LTVJJOMAWHPMKK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|