C26H25ClFN7O2 — CID 130234163
N-[5-[[5-chloro-4-[3-[[2-(4-cyanophenyl)acetyl]amino]propylamino]pyrimidin-2-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide (PubChem CID 130234163) has the molecular formula C26H25ClFN7O2 and a molecular weight of 521.98 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-[3-[[2-(4-cyanophenyl)acetyl]amino]propylamino]pyrimidin-2-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-[3-[[2-(4-cyanophenyl)acetyl]amino]propylamino]pyrimidin-2-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 130234163 |
| Molecular Formula | C26H25ClFN7O2 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[5-[[5-chloro-4-[3-[[2-(4-cyanophenyl)acetyl]amino]propylamino]pyrimidin-2-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1cc(Nc2ncc(Cl)c(NCCCNC(=O)Cc3ccc(C#N)cc3)n2)ccc1F |
| InChI | InChI=1S/C26H25ClFN7O2/c1-3-24(37)35(2)22-14-19(9-10-21(22)28)33-26-32-16-20(27)25(34-26)31-12-4-11-30-23(36)13-17-5-7-18(15-29)8-6-17/h3,5-10,14,16H,1,4,11-13H2,2H3,(H,30,36)(H2,31,32,33,34) |
| InChIKey | KWUREIPOADBHMX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|