C24H31ClFN7O2 — CID 118973617
N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-1-methylpiperidine-4-carboxamide (PubChem CID 118973617) has the molecular formula C24H31ClFN7O2 and a molecular weight of 504.01 g/mol. Its IUPAC name is N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 118973617 |
| Molecular Formula | C24H31ClFN7O2 |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N-[3-[[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]amino]propyl]-1-methylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N(C)c1cc(Nc2ncc(Cl)c(NCCCNC(=O)C3CCN(C)CC3)n2)ccc1F |
| InChI | InChI=1S/C24H31ClFN7O2/c1-4-21(34)33(3)20-14-17(6-7-19(20)26)30-24-29-15-18(25)22(31-24)27-10-5-11-28-23(35)16-8-12-32(2)13-9-16/h4,6-7,14-16H,1,5,8-13H2,2-3H3,(H,28,35)(H2,27,29,30,31) |
| InChIKey | KYZWLADQEGSEIB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|