C28H29ClFN7O2 — CID 130234172
N-[4-amino-6-[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]hexyl]-4-cyanobenzamide (PubChem CID 130234172) has the molecular formula C28H29ClFN7O2 and a molecular weight of 550.04 g/mol. Its IUPAC name is N-[4-amino-6-[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]hexyl]-4-cyanobenzamide.
| Compound Name | N-[4-amino-6-[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]hexyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 130234172 |
| Molecular Formula | C28H29ClFN7O2 |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | N-[4-amino-6-[5-chloro-2-[4-fluoro-3-[methyl(prop-2-enoyl)amino]anilino]pyrimidin-4-yl]hexyl]-4-cyanobenzamide |
| SMILES | C=CC(=O)N(C)c1cc(Nc2ncc(Cl)c(CCC(N)CCCNC(=O)c3ccc(C#N)cc3)n2)ccc1F |
| InChI | InChI=1S/C28H29ClFN7O2/c1-3-26(38)37(2)25-15-21(11-12-23(25)30)35-28-34-17-22(29)24(36-28)13-10-20(32)5-4-14-33-27(39)19-8-6-18(16-31)7-9-19/h3,6-9,11-12,15,17,20H,1,4-5,10,13-14,32H2,2H3,(H,33,39)(H,34,35,36) |
| InChIKey | HXOKXIMWLPYDCW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|