C34H35F5N9O4S- — CID 173493794
CID 173493794 (PubChem CID 173493794) has the molecular formula C34H35F5N9O4S- and a molecular weight of 760.77 g/mol.
| Compound Name | CID 173493794 |
|---|---|
| PubChem CID | 173493794 |
| Molecular Formula | C34H35F5N9O4S- |
| Molecular Weight | 760.77 g/mol |
| Exact Mass | 760.25 |
| IUPAC Name | — |
| SMILES | CCOC(=O)/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(NC(=O)Nc4cc(C(F)(F)F)ccc4F)c(F)c3)c(NCCN3CCN(C)CC3)n2)c1 |
| InChI | InChI=1S/C34H35F5N9O4S/c1-3-52-33(50)46-53(51)24-6-4-5-23(19-24)42-31-41-20-25(30(45-31)40-11-12-48-15-13-47(2)14-16-48)21-7-10-28(27(36)17-21)43-32(49)44-29-18-22(34(37,38)39)8-9-26(29)35/h4-10,17-20H,3,11-16H2,1-2H3,(H2,43,44,49)(H2,40,41,42,45)/q-1 |
| InChIKey | MBANQYFJCBSCKF-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.77 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|