C27H31ClN6O2 — CID 90737479
3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 90737479) has the molecular formula C27H31ClN6O2 and a molecular weight of 507.04 g/mol. Its IUPAC name is 3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90737479 |
| Molecular Formula | C27H31ClN6O2 |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(Nc2ncc(-c3cccc(C=CC(=O)O)c3)c(NCCN3CCN(C)CC3)n2)cc1Cl |
| InChI | InChI=1S/C27H31ClN6O2/c1-19-6-8-22(17-24(19)28)31-27-30-18-23(21-5-3-4-20(16-21)7-9-25(35)36)26(32-27)29-10-11-34-14-12-33(2)13-15-34/h3-9,16-18H,10-15H2,1-2H3,(H,35,36)(H2,29,30,31,32) |
| InChIKey | CEKOQFPNDVPBLH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|