C25H23ClN6O2 — CID 91231090
3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(1H-pyrazol-4-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 91231090) has the molecular formula C25H23ClN6O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(1H-pyrazol-4-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(1H-pyrazol-4-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91231090 |
| Molecular Formula | C25H23ClN6O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 3-[3-[2-(3-chloro-4-methylanilino)-4-[2-(1H-pyrazol-4-yl)ethylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(Nc2ncc(-c3cccc(C=CC(=O)O)c3)c(NCCc3cn[nH]c3)n2)cc1Cl |
| InChI | InChI=1S/C25H23ClN6O2/c1-16-5-7-20(12-22(16)26)31-25-28-15-21(19-4-2-3-17(11-19)6-8-23(33)34)24(32-25)27-10-9-18-13-29-30-14-18/h2-8,11-15H,9-10H2,1H3,(H,29,30)(H,33,34)(H2,27,28,31,32) |
| InChIKey | BUTMFQMILIWHCT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|