C25H24ClFN4O3 — CID 59354437
ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-[[(3R)-oxolan-3-yl]amino]pyrimidin-5-yl]phenyl]prop-2-enoate (PubChem CID 59354437) has the molecular formula C25H24ClFN4O3 and a molecular weight of 482.94 g/mol. Its IUPAC name is ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-[[(3R)-oxolan-3-yl]amino]pyrimidin-5-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-[[(3R)-oxolan-3-yl]amino]pyrimidin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59354437 |
| Molecular Formula | C25H24ClFN4O3 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-[[(3R)-oxolan-3-yl]amino]pyrimidin-5-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2N[C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C25H24ClFN4O3/c1-2-34-23(32)9-6-16-4-3-5-17(12-16)20-14-28-25(30-18-7-8-22(27)21(26)13-18)31-24(20)29-19-10-11-33-15-19/h3-9,12-14,19H,2,10-11,15H2,1H3,(H2,28,29,30,31)/b9-6+/t19-/m1/s1 |
| InChIKey | VCGYJFHWKSRMSO-MBNRZODZSA-N |
| XLogP | 5.46 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|