C23H20ClFN4O3 — CID 68646465
3-[3-[2-(3-chloro-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 68646465) has the molecular formula C23H20ClFN4O3 and a molecular weight of 454.89 g/mol. Its IUPAC name is 3-[3-[2-(3-chloro-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(3-chloro-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68646465 |
| Molecular Formula | C23H20ClFN4O3 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-[3-[2-(3-chloro-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H20ClFN4O3/c24-19-13-17(5-6-20(19)25)27-23-26-14-18(22(28-23)29-8-10-32-11-9-29)16-3-1-2-15(12-16)4-7-21(30)31/h1-7,12-14H,8-11H2,(H,30,31)(H,26,27,28) |
| InChIKey | NREPLKMBEWISFB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|