C25H23N5O3 — CID 59353298
(E)-3-[3-[2-(1H-indol-7-ylamino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 59353298) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is (E)-3-[3-[2-(1H-indol-7-ylamino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(1H-indol-7-ylamino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59353298 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (E)-3-[3-[2-(1H-indol-7-ylamino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cnc(Nc3cccc4cc[nH]c34)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C25H23N5O3/c31-22(32)8-7-17-3-1-5-19(15-17)20-16-27-25(29-24(20)30-11-13-33-14-12-30)28-21-6-2-4-18-9-10-26-23(18)21/h1-10,15-16,26H,11-14H2,(H,31,32)(H,27,28,29)/b8-7+ |
| InChIKey | VKUXZVVZUUMZDY-BQYQJAHWSA-N |
| XLogP | 4.30 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|