C28H32N8O4 — CID 143967056
ethyl (E)-3-[3-[2-[3-[1-(aminodiazenyl)ethylideneamino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoate (PubChem CID 143967056) has the molecular formula C28H32N8O4 and a molecular weight of 544.62 g/mol. Its IUPAC name is ethyl (E)-3-[3-[2-[3-[1-(aminodiazenyl)ethylideneamino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[2-[3-[1-(aminodiazenyl)ethylideneamino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 143967056 |
| Molecular Formula | C28H32N8O4 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | ethyl (E)-3-[3-[2-[3-[1-(aminodiazenyl)ethylideneamino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2cnc(Nc3cc(/N=C(C)/N=N/N)cc(OC)c3)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C28H32N8O4/c1-4-40-26(37)9-8-20-6-5-7-21(14-20)25-18-30-28(33-27(25)36-10-12-39-13-11-36)32-23-15-22(16-24(17-23)38-3)31-19(2)34-35-29/h5-9,14-18H,4,10-13H2,1-3H3,(H2,29,31,34)(H,30,32,33)/b9-8+ |
| InChIKey | NMCUTSWMOKOFPH-CMDGGOBGSA-N |
| XLogP | 4.68 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|