C32H45N7O4 — CID 143967132
(E)-3-[3-[2-[3-[amino(prop-1-en-2-yl)amino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid;butane;methanamine (PubChem CID 143967132) has the molecular formula C32H45N7O4 and a molecular weight of 591.76 g/mol. Its IUPAC name is (E)-3-[3-[2-[3-[amino(prop-1-en-2-yl)amino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid;butane;methanamine.
| Compound Name | (E)-3-[3-[2-[3-[amino(prop-1-en-2-yl)amino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid;butane;methanamine |
|---|---|
| PubChem CID | 143967132 |
| Molecular Formula | C32H45N7O4 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | (E)-3-[3-[2-[3-[amino(prop-1-en-2-yl)amino]-5-methoxyanilino]-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid;butane;methanamine |
| SMILES | C=C(C)N(N)c1cc(Nc2ncc(-c3cccc(/C=C/C(=O)O)c3)c(N3CCOCC3)n2)cc(OC)c1.CCCC.CN |
| InChI | InChI=1S/C27H30N6O4.C4H10.CH5N/c1-18(2)33(28)22-14-21(15-23(16-22)36-3)30-27-29-17-24(26(31-27)32-9-11-37-12-10-32)20-6-4-5-19(13-20)7-8-25(34)35;1-3-4-2;1-2/h4-8,13-17H,1,9-12,28H2,2-3H3,(H,34,35)(H,29,30,31);3-4H2,1-2H3;2H2,1H3/b8-7+;; |
| InChIKey | BHKLWZYWRKDMDR-MIIBGCIDSA-N |
| XLogP | 5.43 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|